cas: 16264-67-8 — see every product listed under this CAS number, including other names
4,5,6,7-Tetrafluoro-1H-indole, 98%, 98% (CAS 16264-67-8) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch112TAE-100mg |
| cas | 16264-67-8 |
| size | 100mg |
| availability | 2g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 515.60 Pln | |
| Chemat | 250mg | 741.20 Pln | |
| Chemat | 1g | 2718.80 Pln |
| purity | 98% |
|---|---|
| delivery time | 3 weeks |
4,5,6,7-tetrafluoro-1H-indole (CAS 16264-67-8) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 4,5,6,7-tetrafluoro-1H-indole. InChIKey: DTNBMVQXEVNTLO-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 4,5,6,7-tetrafluoro-1H-indole |
| InChIKey | DTNBMVQXEVNTLO-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)