cas: 16264-67-8 — see every product listed under this CAS number, including other names
4,5,6,7-Tetrafluoroindole (CAS 16264-67-8) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 100mg, 1g, 5g, 10g. Offered by: TRC, Fluorochem.
| brand | TRC |
|---|---|
| catalog number | TRC-T311028-250MG |
| cas | 16264-67-8 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| TRC | 250mg | price on request | |
| Fluorochem | 100mg | 825.77 Pln | |
| Fluorochem | 250mg | 1200.64 Pln | |
| Fluorochem | 1g | 4475.53 Pln | |
| Fluorochem | 5g | 11165.88 Pln | |
| Fluorochem | 10g | 18569.52 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4,5,6,7-tetrafluoro-1H-indole (CAS 16264-67-8) is a chemical compound with the molecular formula C8H3F4N and a molecular weight of 189.11 g/mol. IUPAC name: 4,5,6,7-tetrafluoro-1H-indole. InChIKey: DTNBMVQXEVNTLO-UHFFFAOYSA-N.
| Molecular formula | C8H3F4N |
|---|---|
| Molecular weight | 189.11 g/mol |
| IUPAC name | 4,5,6,7-tetrafluoro-1H-indole |
| InChIKey | DTNBMVQXEVNTLO-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=C(C(=C2F)F)F)F |
Computed by PubChem (NCBI)