cas: 888720-61-4 — see every product listed under this CAS number, including other names
4,5-Dichloropyrrolo(2,1-f)(1,2,4)triazine, 95% (CAS 888720-61-4) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g, 1g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A659910-5g |
| cas | 888720-61-4 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 33075.70 Pln | |
| AmBeed | 10g | 40008.85 Pln | |
| AmBeed | 1g | 11071.90 Pln |
| purity | 95% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,5-dichloropyrrolo[2,1-f][1,2,4]triazine (CAS 888720-61-4) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4,5-dichloropyrrolo[2,1-f][1,2,4]triazine. InChIKey: QUFRWQJHIBMRGA-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4,5-dichloropyrrolo[2,1-f][1,2,4]triazine |
| InChIKey | QUFRWQJHIBMRGA-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=C1Cl)C(=NC=N2)Cl |
Computed by PubChem (NCBI)