cas: 126714-85-0 — see every product listed under this CAS number, including other names
4,5-Dichlorothiophene-2-sulfonyl chloride, 97+% (CAS 126714-85-0) is a chemical reagent available from Chemat. Available pack sizes: 1g, 25g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A316247-1g |
| cas | 126714-85-0 |
| size | 1g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 1g | 323.89 Pln | |
| AmBeed | 25g | 1710.52 Pln |
| purity | 97+% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,5-dichlorothiophene-2-sulfonyl chloride (CAS 126714-85-0) is a chemical compound with the molecular formula C4HCl3O2S2 and a molecular weight of 251.5 g/mol. IUPAC name: 4,5-dichlorothiophene-2-sulfonyl chloride. InChIKey: IVTWLTRKVRJPNG-UHFFFAOYSA-N.
| Molecular formula | C4HCl3O2S2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 4,5-dichlorothiophene-2-sulfonyl chloride |
| InChIKey | IVTWLTRKVRJPNG-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)