Products 56946-83-9

CAS 56946-83-9 appears in our catalog under these names: 2,5-Dichlorothiophene-3-sulfonyl chloride, 98%, 2,5-Dichlorothiophene-3-sulfonyl chloride, 97% , 2,5-Dichlorothiophene-3-sulfonyl chloride, 95%. Offered by: Combi-blocks, AmBeed, Thermo Scientific (Alfa Aesar), Fluorochem. Available pack sizes: 10g, 5g, 25g, 1g.

Structural formula: {0} (CAS {1})

2,5-dichlorothiophene-3-sulfonyl chloride (CAS 56946-83-9) is a chemical compound with the molecular formula C4HCl3O2S2 and a molecular weight of 251.5 g/mol. IUPAC name: 2,5-dichlorothiophene-3-sulfonyl chloride. InChIKey: JJKSHSHZJOWSEC-UHFFFAOYSA-N.

Identity
Molecular formulaC4HCl3O2S2
Molecular weight251.5 g/mol
IUPAC name2,5-dichlorothiophene-3-sulfonyl chloride
InChIKeyJJKSHSHZJOWSEC-UHFFFAOYSA-N
SMILESC1=C(SC(=C1S(=O)(=O)Cl)Cl)Cl

Computed by PubChem (NCBI)