CAS 126714-85-0 appears in our catalog under these names: 2,3-Dichlorothiophene-5-sulfonyl chloride, 95%, 4,5-Dichlorothiophene-2-sulfonyl chloride, 97+%, 4,5–Dichlorothiophene–2–sulfonyl chloride, 2,3-Dichlorothiophene-5-sulfonyl chloride. Offered by: Combi-blocks, AmBeed, GLPBio, Fluorochem. Available pack sizes: 5g, 1g, 25g, 10g.
4,5-dichlorothiophene-2-sulfonyl chloride (CAS 126714-85-0) is a chemical compound with the molecular formula C4HCl3O2S2 and a molecular weight of 251.5 g/mol. IUPAC name: 4,5-dichlorothiophene-2-sulfonyl chloride. InChIKey: IVTWLTRKVRJPNG-UHFFFAOYSA-N.
| Molecular formula | C4HCl3O2S2 |
|---|---|
| Molecular weight | 251.5 g/mol |
| IUPAC name | 4,5-dichlorothiophene-2-sulfonyl chloride |
| InChIKey | IVTWLTRKVRJPNG-UHFFFAOYSA-N |
| SMILES | C1=C(SC(=C1Cl)Cl)S(=O)(=O)Cl |
Computed by PubChem (NCBI)