cas: 5374-06-1 — see every product listed under this CAS number, including other names
4,6-Di-tert-butylresorcinol 98% (CAS 5374-06-1) is a chemical reagent available from Chemat. Available pack sizes: 1g, 5g, 25g, 100g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A573146-1g |
| cas | 5374-06-1 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 1g | 120.06 Pln | |
| Ambeed | 5g | 253.56 Pln | |
| Ambeed | 25g | 804.25 Pln | |
| Ambeed | 100g | 2367.31 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A573146 |
4,6-ditert-butylbenzene-1,3-diol (CAS 5374-06-1) is a chemical compound with the molecular formula C14H22O2 and a molecular weight of 222.32 g/mol. IUPAC name: 4,6-ditert-butylbenzene-1,3-diol. InChIKey: KJFMXIXXYWHFAN-UHFFFAOYSA-N.
| Molecular formula | C14H22O2 |
|---|---|
| Molecular weight | 222.32 g/mol |
| IUPAC name | 4,6-ditert-butylbenzene-1,3-diol |
| InChIKey | KJFMXIXXYWHFAN-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=C(C=C1O)O)C(C)(C)C |
Computed by PubChem (NCBI)