Products 1329969-53-0
CAS 1329969-53-0 is the registry number for 4,6-Dibromo-2-(trifluoromethyl)pyrimidine, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g.
4,6-dibromo-2-(trifluoromethyl)pyrimidine (CAS 1329969-53-0) is a chemical compound with the molecular formula C5HBr2F3N2 and a molecular weight of 305.88 g/mol. IUPAC name: 4,6-dibromo-2-(trifluoromethyl)pyrimidine. InChIKey: TXYFNXKWKULTFM-UHFFFAOYSA-N.
| Molecular formula | C5HBr2F3N2 |
|---|---|
| Molecular weight | 305.88 g/mol |
| IUPAC name | 4,6-dibromo-2-(trifluoromethyl)pyrimidine |
| InChIKey | TXYFNXKWKULTFM-UHFFFAOYSA-N |
| SMILES | C1=C(N=C(N=C1Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)