CAS 1073525-71-9 appears in our catalog under these names: 3,4-dibromo-6-(trifluoromethyl)pyridazine, 3,4-Dibromo-6-(trifluoromethyl)pyridazine, 97%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 1g, 50mg, 250mg.
3,4-dibromo-6-(trifluoromethyl)pyridazine (CAS 1073525-71-9) is a chemical compound with the molecular formula C5HBr2F3N2 and a molecular weight of 305.88 g/mol. IUPAC name: 3,4-dibromo-6-(trifluoromethyl)pyridazine. InChIKey: NRHAURZCUNKMEV-UHFFFAOYSA-N.
| Molecular formula | C5HBr2F3N2 |
|---|---|
| Molecular weight | 305.88 g/mol |
| IUPAC name | 3,4-dibromo-6-(trifluoromethyl)pyridazine |
| InChIKey | NRHAURZCUNKMEV-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NN=C1C(F)(F)F)Br)Br |
Computed by PubChem (NCBI)