Products 785777-91-5
CAS 785777-91-5 is the registry number for 2,5-Dibromo-4-(trifluoromethyl)pyrimidine. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
2,5-dibromo-4-(trifluoromethyl)pyrimidine (CAS 785777-91-5) is a chemical compound with the molecular formula C5HBr2F3N2 and a molecular weight of 305.88 g/mol. IUPAC name: 2,5-dibromo-4-(trifluoromethyl)pyrimidine. InChIKey: VBRLEROVGVYLPR-UHFFFAOYSA-N.
| Molecular formula | C5HBr2F3N2 |
|---|---|
| Molecular weight | 305.88 g/mol |
| IUPAC name | 2,5-dibromo-4-(trifluoromethyl)pyrimidine |
| InChIKey | VBRLEROVGVYLPR-UHFFFAOYSA-N |
| SMILES | C1=C(C(=NC(=N1)Br)C(F)(F)F)Br |
Computed by PubChem (NCBI)