cas: 2589-12-0 — see every product listed under this CAS number, including other names
4,6-Dichloro-1H-imidazo[4,5-c]pyridine, 95% (CAS 2589-12-0) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F076907-100MG |
| cas | 2589-12-0 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 100mg | 91.65 Pln | |
| Fluorochem | 250mg | 112.48 Pln | |
| Fluorochem | 1g | 221.81 Pln | |
| Fluorochem | 5g | 575.86 Pln | |
| Fluorochem | 10g | 1096.51 Pln | |
| Fluorochem | 25g | 2637.63 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,6-dichloro-1H-imidazo[4,5-c]pyridine (CAS 2589-12-0) is a chemical compound with the molecular formula C6H3Cl2N3 and a molecular weight of 188.01 g/mol. IUPAC name: 4,6-dichloro-1H-imidazo[4,5-c]pyridine. InChIKey: FDXNZTUWNBRZDX-UHFFFAOYSA-N.
| Molecular formula | C6H3Cl2N3 |
|---|---|
| Molecular weight | 188.01 g/mol |
| IUPAC name | 4,6-dichloro-1H-imidazo[4,5-c]pyridine |
| InChIKey | FDXNZTUWNBRZDX-UHFFFAOYSA-N |
| SMILES | C1=C2C(=C(N=C1Cl)Cl)N=CN2 |
Computed by PubChem (NCBI)