cas: 101495-18-5 — see every product listed under this CAS number, including other names
4,6-Dichloro-1H-indole, 95% (CAS 101495-18-5) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 10g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F040404-250MG |
| cas | 101495-18-5 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 143.72 Pln | |
| Fluorochem | 1g | 268.67 Pln | |
| Fluorochem | 5g | 1127.75 Pln | |
| Fluorochem | 10g | 2200.28 Pln | |
| Fluorochem | 25g | 5407.49 Pln |
| purity | 95% |
|---|---|
| delivery time | 3-4 weeks |
4,6-dichloro-1H-indole (CAS 101495-18-5) is a chemical compound with the molecular formula C8H5Cl2N and a molecular weight of 186.03 g/mol. IUPAC name: 4,6-dichloro-1H-indole. InChIKey: NIXGYRHZQFZCCV-UHFFFAOYSA-N.
| Molecular formula | C8H5Cl2N |
|---|---|
| Molecular weight | 186.03 g/mol |
| IUPAC name | 4,6-dichloro-1H-indole |
| InChIKey | NIXGYRHZQFZCCV-UHFFFAOYSA-N |
| SMILES | C1=CNC2=C1C(=CC(=C2)Cl)Cl |
Computed by PubChem (NCBI)