cas: 42754-96-1 — see every product listed under this CAS number, including other names
4,6-Dichloro-1H-pyrazolo[3,4-d]pyrimidine 97% (CAS 42754-96-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g, 100g, 500g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A174726-100mg |
| cas | 42754-96-1 |
| size | 100mg |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 175.69 Pln | |
| Ambeed | 250mg | 197.94 Pln | |
| Ambeed | 1g | 220.19 Pln | |
| Ambeed | 5g | 281.38 Pln | |
| Ambeed | 25g | 776.44 Pln | |
| Ambeed | 100g | 2662.12 Pln | |
| Ambeed | 500g | 10438.50 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A174726 |
4,6-dichloro-1H-pyrazolo[5,4-d]pyrimidine (CAS 42754-96-1) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 4,6-dichloro-1H-pyrazolo[5,4-d]pyrimidine. InChIKey: CTYPROOLWJDUTA-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 4,6-dichloro-1H-pyrazolo[5,4-d]pyrimidine |
| InChIKey | CTYPROOLWJDUTA-UHFFFAOYSA-N |
| SMILES | C1=NNC2=C1C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)