CAS 17998-43-5 appears in our catalog under these names: 4,7-Dichloro-1h-imidazo[4,5-d]pyridazine, 95%, 4,7-Dichloro-1H-imidazo(4,5-d)pyridazine, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 100mg.
4,7-dichloro-1H-imidazo[4,5-d]pyridazine (CAS 17998-43-5) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 4,7-dichloro-1H-imidazo[4,5-d]pyridazine. InChIKey: KDFRQLMTRRFLKG-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 4,7-dichloro-1H-imidazo[4,5-d]pyridazine |
| InChIKey | KDFRQLMTRRFLKG-UHFFFAOYSA-N |
| SMILES | C1=NC2=C(N1)C(=NN=C2Cl)Cl |
Computed by PubChem (NCBI)