Products 1936295-68-9
CAS 1936295-68-9 is the registry number for 2,8-Dichloro-[1,2,4]triazolo[1,5-a]pyrazine, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g, 250mg.
2,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine (CAS 1936295-68-9) is a chemical compound with the molecular formula C5H2Cl2N4 and a molecular weight of 189.00 g/mol. IUPAC name: 2,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine. InChIKey: YLVRZRYAGGGOFC-UHFFFAOYSA-N.
| Molecular formula | C5H2Cl2N4 |
|---|---|
| Molecular weight | 189.00 g/mol |
| IUPAC name | 2,8-dichloro-[1,2,4]triazolo[1,5-a]pyrazine |
| InChIKey | YLVRZRYAGGGOFC-UHFFFAOYSA-N |
| SMILES | C1=CN2C(=NC(=N2)Cl)C(=N1)Cl |
Computed by PubChem (NCBI)