cas: 26870-72-4 — see every product listed under this CAS number, including other names
4,6-Dichloro-2-(4-chlorophenyl)pyrimidine, 98% (CAS 26870-72-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 250mg, 1g, 5g. Offered by: AmBeed, Fluorochem, Chemat.
| brand | AmBeed |
|---|---|
| catalog number | A1733497-10g |
| cas | 26870-72-4 |
| size | 10g |
| availability | Synthetic Items: 0g |
Ask us about this product — we're happy to help.
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 26930.26 Pln | |
| Fluorochem | 100mg | 726.85 Pln | |
| Fluorochem | 250mg | 1700.46 Pln | |
| Fluorochem | 1g | 3319.68 Pln | |
| Fluorochem | 5g | 11764.63 Pln | |
| Fluorochem | 10g | 20016.93 Pln | |
| Chemat | 100mg | 342.80 Pln | |
| Chemat | 250mg | 760.40 Pln | |
| Chemat | 1g | 1586.00 Pln | |
| Chemat | 5g | 3045.20 Pln |
| purity | 98% |
|---|---|
| delivery time | To be confirmed by Chemat |
4,6-dichloro-2-(4-chlorophenyl)pyrimidine (CAS 26870-72-4) is a chemical compound with the molecular formula C10H5Cl3N2 and a molecular weight of 259.5 g/mol. IUPAC name: 4,6-dichloro-2-(4-chlorophenyl)pyrimidine. InChIKey: GFMYIEIPQDGPCN-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3N2 |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 4,6-dichloro-2-(4-chlorophenyl)pyrimidine |
| InChIKey | GFMYIEIPQDGPCN-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=NC(=CC(=N2)Cl)Cl)Cl |
Computed by PubChem (NCBI)