CAS 849021-04-1 is the registry number for 3-(3-Chlorophenyl)-4,6-dichloropyridazine, 95%. Offered by: Fluorochem. Available pack sizes: 1g.
4,6-dichloro-3-(3-chlorophenyl)pyridazine (CAS 849021-04-1) is a chemical compound with the molecular formula C10H5Cl3N2 and a molecular weight of 259.5 g/mol. IUPAC name: 4,6-dichloro-3-(3-chlorophenyl)pyridazine. InChIKey: XVJPVYRLVRCSKD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3N2 |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 4,6-dichloro-3-(3-chlorophenyl)pyridazine |
| InChIKey | XVJPVYRLVRCSKD-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC(=C1)Cl)C2=NN=C(C=C2Cl)Cl |
Computed by PubChem (NCBI)