CAS 1934539-65-7 is the registry number for 2-Chloro-5-(2,3-dichlorophenyl)pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-chloro-5-(2,3-dichlorophenyl)pyrazine (CAS 1934539-65-7) is a chemical compound with the molecular formula C10H5Cl3N2 and a molecular weight of 259.5 g/mol. IUPAC name: 2-chloro-5-(2,3-dichlorophenyl)pyrazine. InChIKey: PUJXOGSUULOQOD-UHFFFAOYSA-N.
| Molecular formula | C10H5Cl3N2 |
|---|---|
| Molecular weight | 259.5 g/mol |
| IUPAC name | 2-chloro-5-(2,3-dichlorophenyl)pyrazine |
| InChIKey | PUJXOGSUULOQOD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C2=CN=C(C=N2)Cl |
Computed by PubChem (NCBI)