cas: 1609393-89-6 — see every product listed under this CAS number, including other names
4,6-Dichloro-N-methylpyridazine-3-carboxamide-d3, 98.51% (CAS 1609393-89-6) is a chemical reagent available from Chemat. Available pack sizes: 5 g, 500 mg, 25 g, 1 g, 10 g. Offered by: MedChemExpress.
| brand | MedChemExpress |
|---|---|
| catalog number | HY-45842S-5 g |
| cas | 1609393-89-6 |
| size | 5 g |
| availability | In stock |
| brand | size | price | |
|---|---|---|---|
| MedChemExpress | 5 g | 1048.80 Pln | |
| MedChemExpress | 500 mg | 254.68 Pln | |
| MedChemExpress | 25 g | 3765.54 Pln | |
| MedChemExpress | 1 g | 328.98 Pln | |
| MedChemExpress | 10 g | 1856.86 Pln |
| delivery time | 2-3 weeks |
|---|---|
| purity | 98.51% |
4,6-dichloro-N-(trideuteriomethyl)pyridazine-3-carboxamide (CAS 1609393-89-6) is a chemical compound with the molecular formula C6H5Cl2N3O and a molecular weight of 209.04 g/mol. IUPAC name: 4,6-dichloro-N-(trideuteriomethyl)pyridazine-3-carboxamide. InChIKey: KVLSUFLTCCJFAG-FIBGUPNXSA-N.
| Molecular formula | C6H5Cl2N3O |
|---|---|
| Molecular weight | 209.04 g/mol |
| IUPAC name | 4,6-dichloro-N-(trideuteriomethyl)pyridazine-3-carboxamide |
| InChIKey | KVLSUFLTCCJFAG-FIBGUPNXSA-N |
| SMILES | [2H]C([2H])([2H])NC(=O)C1=NN=C(C=C1Cl)Cl |
Computed by PubChem (NCBI)