CAS 16866-52-7 appears in our catalog under these names: 3,6-Dichloropicolinohydrazide, 95+%, 3，6–dichloropyridine–2–carbohydrazide. Offered by: AmBeed, GLPBio. Available pack sizes: 5g, 25g.
3,6-dichloropyridine-2-carbohydrazide (CAS 16866-52-7) is a chemical compound with the molecular formula C6H5Cl2N3O and a molecular weight of 206.03 g/mol. IUPAC name: 3,6-dichloropyridine-2-carbohydrazide. InChIKey: FGBOJFXITSZYAA-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2N3O |
|---|---|
| Molecular weight | 206.03 g/mol |
| IUPAC name | 3,6-dichloropyridine-2-carbohydrazide |
| InChIKey | FGBOJFXITSZYAA-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC(=C1Cl)C(=O)NN)Cl |
Computed by PubChem (NCBI)