CAS 57803-51-7 appears in our catalog under these names: 2,6-Dichloroisonicotinohydrazide, 98%, 2,6-Dichloro-isonicotinic Acid Hydrazide, 2,6-Dichloroisonicotinohydrazide, 97%. Offered by: Combi-blocks, TRC, AmBeed. Available pack sizes: 5g, 250mg, 1g.
2,6-dichloropyridine-4-carbohydrazide (CAS 57803-51-7) is a chemical compound with the molecular formula C6H5Cl2N3O and a molecular weight of 206.03 g/mol. IUPAC name: 2,6-dichloropyridine-4-carbohydrazide. InChIKey: QZTMHCLQBRFNOF-UHFFFAOYSA-N.
| Molecular formula | C6H5Cl2N3O |
|---|---|
| Molecular weight | 206.03 g/mol |
| IUPAC name | 2,6-dichloropyridine-4-carbohydrazide |
| InChIKey | QZTMHCLQBRFNOF-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(N=C1Cl)Cl)C(=O)NN |
Computed by PubChem (NCBI)