cas: 99844-02-7 — see every product listed under this CAS number, including other names
4–(4–Methoxyphenyl)pyrimidin–2–amine (CAS 99844-02-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF28612-100mg |
| cas | 99844-02-7 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100mg | 522.15 Pln | |
| GLPBio | 1g | 770.22 Pln | |
| GLPBio | 250mg | 568.96 Pln | |
| GLPBio | 5g | 1654.83 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-(4-methoxyphenyl)pyrimidin-2-amine (CAS 99844-02-7) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 4-(4-methoxyphenyl)pyrimidin-2-amine. InChIKey: GHSMJZASRNAUBJ-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 4-(4-methoxyphenyl)pyrimidin-2-amine |
| InChIKey | GHSMJZASRNAUBJ-UHFFFAOYSA-N |
| SMILES | COC1=CC=C(C=C1)C2=NC(=NC=C2)N |
Computed by PubChem (NCBI)