CAS 1019079-11-8 is the registry number for 1-[4-(1H-Pyrazol-1-yl)phenyl]ethanone oxime, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
(NE)-N-[1-(4-pyrazol-1-ylphenyl)ethylidene]hydroxylamine (CAS 1019079-11-8) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: (NE)-N-[1-(4-pyrazol-1-ylphenyl)ethylidene]hydroxylamine. InChIKey: ISBXZCCXVXTLMO-UKTHLTGXSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | (NE)-N-[1-(4-pyrazol-1-ylphenyl)ethylidene]hydroxylamine |
| InChIKey | ISBXZCCXVXTLMO-UKTHLTGXSA-N |
| SMILES | C/C(=N\O)/C1=CC=C(C=C1)N2C=CC=N2 |
Computed by PubChem (NCBI)