CAS 952183-31-2 is the registry number for 1-(4-Methylbenzyl)-1h-1,2,3-triazole-4-carbaldehyde, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 10g, 1g, 5g.
1-[(4-methylphenyl)methyl]triazole-4-carbaldehyde (CAS 952183-31-2) is a chemical compound with the molecular formula C11H11N3O and a molecular weight of 201.22 g/mol. IUPAC name: 1-[(4-methylphenyl)methyl]triazole-4-carbaldehyde. InChIKey: JLKGISTXFFZYFL-UHFFFAOYSA-N.
| Molecular formula | C11H11N3O |
|---|---|
| Molecular weight | 201.22 g/mol |
| IUPAC name | 1-[(4-methylphenyl)methyl]triazole-4-carbaldehyde |
| InChIKey | JLKGISTXFFZYFL-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)CN2C=C(N=N2)C=O |
Computed by PubChem (NCBI)