cas: 1011731-99-9 — see every product listed under this CAS number, including other names
4–(dimethylcarbamoyl)–3–methylphenylboronic acid pinacol ester (CAS 1011731-99-9) is a chemical reagent available from Chemat. Available pack sizes: 1g, 250mg, 50mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF28241-1g |
| cas | 1011731-99-9 |
| size | 1g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 1g | 737.45 Pln | |
| GLPBio | 250mg | 662.57 Pln | |
| GLPBio | 50mg | 536.19 Pln | |
| GLPBio | 5g | 1388.04 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide (CAS 1011731-99-9) is a chemical compound with the molecular formula C16H24BNO3 and a molecular weight of 289.2 g/mol. IUPAC name: N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide. InChIKey: CCVQRQAYAOUDGP-UHFFFAOYSA-N.
| Molecular formula | C16H24BNO3 |
|---|---|
| Molecular weight | 289.2 g/mol |
| IUPAC name | N,N,2-trimethyl-4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)benzamide |
| InChIKey | CCVQRQAYAOUDGP-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC(=C(C=C2)C(=O)N(C)C)C |
Computed by PubChem (NCBI)