cas: 878671-94-4 — see every product listed under this CAS number, including other names
4–Cyclopropylnaphthalen–1–amine (CAS 878671-94-4) is a chemical reagent available from Chemat. Available pack sizes: 10g, 1g, 250mg, 5g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GF25372-10g |
| cas | 878671-94-4 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 10g | 4767.37 Pln | |
| GLPBio | 1g | 1280.39 Pln | |
| GLPBio | 250mg | 760.86 Pln | |
| GLPBio | 5g | 3021.54 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
4-cyclopropylnaphthalen-1-amine (CAS 878671-94-4) is a chemical compound with the molecular formula C13H13N and a molecular weight of 183.25 g/mol. IUPAC name: 4-cyclopropylnaphthalen-1-amine. InChIKey: NYKSBMRQNSCVMO-UHFFFAOYSA-N.
| Molecular formula | C13H13N |
|---|---|
| Molecular weight | 183.25 g/mol |
| IUPAC name | 4-cyclopropylnaphthalen-1-amine |
| InChIKey | NYKSBMRQNSCVMO-UHFFFAOYSA-N |
| SMILES | C1CC1C2=CC=C(C3=CC=CC=C23)N |
Computed by PubChem (NCBI)