cas: 4495-66-3 — see every product listed under this CAS number, including other names
4’–(Benzyloxy)propiophenone (CAS 4495-66-3) is a chemical reagent available from Chemat. Available pack sizes: 100g, 10g, 250g, 25g, 50g. Offered by: GLPBio.
| brand | GLPBio |
|---|---|
| catalog number | GD03053-100g |
| cas | 4495-66-3 |
| size | 100g |
| brand | size | price | |
|---|---|---|---|
| GLPBio | 100g | 1060.41 Pln | |
| GLPBio | 10g | 522.15 Pln | |
| GLPBio | 250g | 1673.55 Pln | |
| GLPBio | 25g | 629.80 Pln | |
| GLPBio | 50g | 817.02 Pln |
| purity | No data |
|---|---|
| delivery time | To be confirmed by Chemat |
1-(4-phenylmethoxyphenyl)propan-1-one (CAS 4495-66-3) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 1-(4-phenylmethoxyphenyl)propan-1-one. InChIKey: IKFGSOJYHVTNDV-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 1-(4-phenylmethoxyphenyl)propan-1-one |
| InChIKey | IKFGSOJYHVTNDV-UHFFFAOYSA-N |
| SMILES | CCC(=O)C1=CC=C(C=C1)OCC2=CC=CC=C2 |
Computed by PubChem (NCBI)