cas: 20525-20-6 — see every product listed under this CAS number, including other names
4′-Bromoflavone 97% (CAS 20525-20-6) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A496013-250mg |
| cas | 20525-20-6 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 147.88 Pln | |
| Ambeed | 1g | 236.88 Pln | |
| Ambeed | 5g | 620.69 Pln | |
| Ambeed | 25g | 2033.56 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A496013 |
2-(4-bromophenyl)chromen-4-one (CAS 20525-20-6) is a chemical compound with the molecular formula C15H9BrO2 and a molecular weight of 301.13 g/mol. IUPAC name: 2-(4-bromophenyl)chromen-4-one. InChIKey: URZUAHXELZUWFE-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)chromen-4-one |
| InChIKey | URZUAHXELZUWFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)