CAS 7598-10-9 appears in our catalog under these names: 2-(Bromomethyl)anthraquinone, 95%, 2-(Bromomethyl)anthracene-9,10-dione, 97%, 2-Bromomethyl anthraquinone, 2-(BROMOMETHYL)ANTHRAQUINONE. Offered by: Combi-blocks, AmBeed, Biosynth, Sigma-Aldrich. Available pack sizes: 1g, 5g, 25g, 10g, 0,5g, 2g.
2-(bromomethyl)anthracene-9,10-dione (CAS 7598-10-9) is a chemical compound with the molecular formula C15H9BrO2 and a molecular weight of 301.13 g/mol. IUPAC name: 2-(bromomethyl)anthracene-9,10-dione. InChIKey: FCETXLHFBYOVCV-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 2-(bromomethyl)anthracene-9,10-dione |
| InChIKey | FCETXLHFBYOVCV-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C3=C(C2=O)C=C(C=C3)CBr |
Computed by PubChem (NCBI)