CAS 20525-20-6 appears in our catalog under these names: 4'-Bromoflavone, 95%, 4’-Bromoflavone, 4'-Bromoflavone, 4′-Bromoflavone 97%, 2-(4-Bromophenyl)-4H-chromen-4-one, 97%, 97%. Offered by: Combi-blocks, TRC, Biosynth, Ambeed, Chemat. Available pack sizes: 1g, 25g, 10g, 5g, 2g, 250mg, 1 g, 10mM/1mL.
2-(4-bromophenyl)chromen-4-one (CAS 20525-20-6) is a chemical compound with the molecular formula C15H9BrO2 and a molecular weight of 301.13 g/mol. IUPAC name: 2-(4-bromophenyl)chromen-4-one. InChIKey: URZUAHXELZUWFE-UHFFFAOYSA-N.
| Molecular formula | C15H9BrO2 |
|---|---|
| Molecular weight | 301.13 g/mol |
| IUPAC name | 2-(4-bromophenyl)chromen-4-one |
| InChIKey | URZUAHXELZUWFE-UHFFFAOYSA-N |
| SMILES | C1=CC=C2C(=C1)C(=O)C=C(O2)C3=CC=C(C=C3)Br |
Computed by PubChem (NCBI)