cas: 690646-18-5 — see every product listed under this CAS number, including other names
4-((2,3,5,6-Tetramethylphenylsulfonamido)methyl)benzoic acid, 97% (CAS 690646-18-5) is a chemical reagent available from Chemat. Available pack sizes: 5g, 10g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A237998-5g |
| cas | 690646-18-5 |
| size | 5g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 5g | 9294.67 Pln | |
| AmBeed | 10g | 12933.76 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid (CAS 690646-18-5) is a chemical compound with the molecular formula C18H21NO4S and a molecular weight of 347.4 g/mol. IUPAC name: 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid. InChIKey: PQPFGHOAPLHTAE-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | PQPFGHOAPLHTAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)