CAS 690646-18-5 appears in our catalog under these names: 4-(([(2,3,5,6-Tetramethylphenyl)sulfonyl]amino)methyl)benzoic acid, 95%, 4-((2,3,5,6-Tetramethylphenylsulfonamido)methyl)benzoic acid, 97%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 10g, 250mg, 5g, 1g.
4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid (CAS 690646-18-5) is a chemical compound with the molecular formula C18H21NO4S and a molecular weight of 347.4 g/mol. IUPAC name: 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid. InChIKey: PQPFGHOAPLHTAE-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | 4-[[(2,3,5,6-tetramethylphenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | PQPFGHOAPLHTAE-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1C)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O)C)C |
Computed by PubChem (NCBI)