CAS 358377-75-0 is the registry number for Methyl 4-([(3,4-dimethylphenyl)(methylsulfonyl)amino]methyl)benzoate, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
Methyl 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzoate (CAS 358377-75-0) is a chemical compound with the molecular formula C18H21NO4S and a molecular weight of 347.4 g/mol. IUPAC name: methyl 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzoate. InChIKey: ZBEKKQMGPDVHTI-UHFFFAOYSA-N.
| Molecular formula | C18H21NO4S |
|---|---|
| Molecular weight | 347.4 g/mol |
| IUPAC name | methyl 4-[(3,4-dimethyl-N-methylsulfonylanilino)methyl]benzoate |
| InChIKey | ZBEKKQMGPDVHTI-UHFFFAOYSA-N |
| SMILES | CC1=C(C=C(C=C1)N(CC2=CC=C(C=C2)C(=O)OC)S(=O)(=O)C)C |
Computed by PubChem (NCBI)