cas: 690646-14-1 — see every product listed under this CAS number, including other names
4-((2,5-Dimethylphenylsulfonamido)methyl)benzoic acid, 97% (CAS 690646-14-1) is a chemical reagent available from Chemat. Available pack sizes: 10g, 100mg, 5g. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A291307-10g |
| cas | 690646-14-1 |
| size | 10g |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 10g | 10987.27 Pln | |
| AmBeed | 100mg | 909.79 Pln | |
| AmBeed | 5g | 7855.96 Pln |
| purity | 97% |
|---|---|
| delivery time | To be confirmed by Chemat |
4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid (CAS 690646-14-1) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: 4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid. InChIKey: JLVDOUVDFOGCCD-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | JLVDOUVDFOGCCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)