CAS 690646-14-1 appears in our catalog under these names: 4-(2,5-Dimethylphenylsulfonylaminomethyl)benzoic acid, 95%, 4-((2,5-Dimethylphenylsulfonamido)methyl)benzoic acid, 97%, 4-((2,5-dimethylbenzenesulfonamido)methyl)benzoic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 10g, 250mg, 1g, 5g, 100mg, 0,5g, 50mg.
4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid (CAS 690646-14-1) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: 4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid. InChIKey: JLVDOUVDFOGCCD-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 4-[[(2,5-dimethylphenyl)sulfonylamino]methyl]benzoic acid |
| InChIKey | JLVDOUVDFOGCCD-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C)S(=O)(=O)NCC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)