CAS 38957-46-9 appears in our catalog under these names: 2-(2,4,6-Trimethyl-benzenesulfonylamino)-benzoic acid, 95%, 2-(2,4,6-Trimethylbenzenesulfonamido)benzoic acid, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g, 10g, 250mg, 100mg.
2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid (CAS 38957-46-9) is a chemical compound with the molecular formula C16H17NO4S and a molecular weight of 319.4 g/mol. IUPAC name: 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid. InChIKey: BCVASKVMDGEDKG-UHFFFAOYSA-N.
| Molecular formula | C16H17NO4S |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | 2-[(2,4,6-trimethylphenyl)sulfonylamino]benzoic acid |
| InChIKey | BCVASKVMDGEDKG-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)S(=O)(=O)NC2=CC=CC=C2C(=O)O)C |
Computed by PubChem (NCBI)