cas: 475250-43-2 — see every product listed under this CAS number, including other names
4-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)benzonitrile 97% (CAS 475250-43-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A103430-100mg |
| cas | 475250-43-2 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 220.19 Pln | |
| Ambeed | 250mg | 331.44 Pln | |
| Ambeed | 1g | 648.50 Pln | |
| Ambeed | 5g | 2895.75 Pln |
| purity | 97% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A103430 |
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile (CAS 475250-43-2) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile. InChIKey: IBNNFFDCOHDYJE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
| InChIKey | IBNNFFDCOHDYJE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)