cas: 475250-43-2 — see every product listed under this CAS number, including other names
4-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)benzonitrile, 97%, 97% (CAS 475250-43-2) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11DJIC-100mg |
| cas | 475250-43-2 |
| size | 100mg |
| availability | 3g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 126.80 Pln | |
| Chemat | 250mg | 174.80 Pln | |
| Chemat | 1g | 477.20 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile (CAS 475250-43-2) is a chemical compound with the molecular formula C14H18BNO2 and a molecular weight of 243.11 g/mol. IUPAC name: 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile. InChIKey: IBNNFFDCOHDYJE-UHFFFAOYSA-N.
| Molecular formula | C14H18BNO2 |
|---|---|
| Molecular weight | 243.11 g/mol |
| IUPAC name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]benzonitrile |
| InChIKey | IBNNFFDCOHDYJE-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CC2=CC=C(C=C2)C#N |
Computed by PubChem (NCBI)