cas: 70558-05-3 — see every product listed under this CAS number, including other names
4-((4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl)morpholine 97% (CAS 70558-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A818951-250mg |
| cas | 70558-05-3 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 250mg | 375.94 Pln | |
| Ambeed | 1g | 637.38 Pln | |
| Ambeed | 5g | 2333.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A818951 |
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine (CAS 70558-05-3) is a chemical compound with the molecular formula C11H22BNO3 and a molecular weight of 227.11 g/mol. IUPAC name: 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine. InChIKey: SULANVZCNXJDKS-UHFFFAOYSA-N.
| Molecular formula | C11H22BNO3 |
|---|---|
| Molecular weight | 227.11 g/mol |
| IUPAC name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine |
| InChIKey | SULANVZCNXJDKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CN2CCOCC2 |
Computed by PubChem (NCBI)