cas: 70558-05-3 — see every product listed under this CAS number, including other names
4-[(Tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine, 97%, 97% (CAS 70558-05-3) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch11FGXV-250mg |
| cas | 70558-05-3 |
| size | 250mg |
| availability | 25g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 250mg | 304.40 Pln | |
| Chemat | 1g | 717.20 Pln | |
| Chemat | 5g | 2680.40 Pln |
| purity | 97% |
|---|---|
| delivery time | 3 weeks |
4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine (CAS 70558-05-3) is a chemical compound with the molecular formula C11H22BNO3 and a molecular weight of 227.11 g/mol. IUPAC name: 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine. InChIKey: SULANVZCNXJDKS-UHFFFAOYSA-N.
| Molecular formula | C11H22BNO3 |
|---|---|
| Molecular weight | 227.11 g/mol |
| IUPAC name | 4-[(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)methyl]morpholine |
| InChIKey | SULANVZCNXJDKS-UHFFFAOYSA-N |
| SMILES | B1(OC(C(O1)(C)C)(C)C)CN2CCOCC2 |
Computed by PubChem (NCBI)