cas: 72901-16-7 — see every product listed under this CAS number, including other names
4-((4-Hydroxyphenyl)(pyridin-2-yl)methyl)phenyl acetate, 95%, 95% (CAS 72901-16-7) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: Chemat.
| brand | Chemat |
|---|---|
| catalog number | Ch116ZOI-100mg |
| cas | 72901-16-7 |
| size | 100mg |
| availability | 0.1g |
| brand | size | price | |
|---|---|---|---|
| Chemat | 100mg | 2589.20 Pln |
| purity | 95% |
|---|---|
| delivery time | 3 weeks |
[4-[(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenyl] acetate (CAS 72901-16-7) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: [4-[(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenyl] acetate. InChIKey: IGNJZSFTZVUILA-UHFFFAOYSA-N.
| Molecular formula | C20H17NO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | [4-[(4-hydroxyphenyl)-pyridin-2-ylmethyl]phenyl] acetate |
| InChIKey | IGNJZSFTZVUILA-UHFFFAOYSA-N |
| SMILES | CC(=O)OC1=CC=C(C=C1)C(C2=CC=C(C=C2)O)C3=CC=CC=N3 |
Computed by PubChem (NCBI)