Products 1606979-17-2

CAS 1606979-17-2 is the registry number for 2-(Phenylmethoxy)-3-pyridinecarboxylic acid phenylmethyl ester, 95%. Offered by: Combi-blocks. Available pack sizes: 10g, 25g, 5g, 1g, 250mg.

Structural formula: {0} (CAS {1})

Benzyl 2-phenylmethoxypyridine-3-carboxylate (CAS 1606979-17-2) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: benzyl 2-phenylmethoxypyridine-3-carboxylate. InChIKey: LKDHVTSKZQFZTI-UHFFFAOYSA-N.

Identity
Molecular formulaC20H17NO3
Molecular weight319.4 g/mol
IUPAC namebenzyl 2-phenylmethoxypyridine-3-carboxylate
InChIKeyLKDHVTSKZQFZTI-UHFFFAOYSA-N
SMILESC1=CC=C(C=C1)COC2=C(C=CC=N2)C(=O)OCC3=CC=CC=C3

Computed by PubChem (NCBI)