Products 779341-22-9
CAS 779341-22-9 is the registry number for 3-(4-Cbz-Aminophenyl)phenol, 97%. Offered by: Combi-blocks. Available pack sizes: 10g, 5g, 1g.
Benzyl N-[4-(3-hydroxyphenyl)phenyl]carbamate (CAS 779341-22-9) is a chemical compound with the molecular formula C20H17NO3 and a molecular weight of 319.4 g/mol. IUPAC name: benzyl N-[4-(3-hydroxyphenyl)phenyl]carbamate. InChIKey: MLMGFVWWMWEJSH-UHFFFAOYSA-N.
| Molecular formula | C20H17NO3 |
|---|---|
| Molecular weight | 319.4 g/mol |
| IUPAC name | benzyl N-[4-(3-hydroxyphenyl)phenyl]carbamate |
| InChIKey | MLMGFVWWMWEJSH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)COC(=O)NC2=CC=C(C=C2)C3=CC(=CC=C3)O |
Computed by PubChem (NCBI)