cas: 76660-37-2 — see every product listed under this CAS number, including other names
4-((5-Bromopyrimidin-2-yl)oxy)aniline 98% (CAS 76660-37-2) is a chemical reagent available from Chemat. Available pack sizes: 10g, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A179355-10g |
| cas | 76660-37-2 |
| size | 10g |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 10g | 693.00 Pln | |
| Ambeed | 250mg | 175.69 Pln | |
| Ambeed | 1g | 197.94 Pln | |
| Ambeed | 5g | 381.50 Pln |
| purity | 98% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A179355 |
4-(5-bromopyrimidin-2-yl)oxyaniline (CAS 76660-37-2) is a chemical compound with the molecular formula C10H8BrN3O and a molecular weight of 266.09 g/mol. IUPAC name: 4-(5-bromopyrimidin-2-yl)oxyaniline. InChIKey: NZWKWSKOAISTNU-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 4-(5-bromopyrimidin-2-yl)oxyaniline |
| InChIKey | NZWKWSKOAISTNU-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)OC2=NC=C(C=N2)Br |
Computed by PubChem (NCBI)