CAS 2211054-46-3 appears in our catalog under these names: Macitentan Impurity 13, 6-Amino-5-(4-bromophenyl)-4(3H)-pyrimidinone. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
4-amino-5-(4-bromophenyl)-1H-pyrimidin-6-one (CAS 2211054-46-3) is a chemical compound with the molecular formula C10H8BrN3O and a molecular weight of 266.09 g/mol. IUPAC name: 4-amino-5-(4-bromophenyl)-1H-pyrimidin-6-one. InChIKey: ZSLCMLTUWSOLAF-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 4-amino-5-(4-bromophenyl)-1H-pyrimidin-6-one |
| InChIKey | ZSLCMLTUWSOLAF-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1C2=C(N=CNC2=O)N)Br |
Computed by PubChem (NCBI)