CAS 2251054-36-9 is the registry number for 4-Bromo-2-(pyridin-4-ylmethyl)-2,3-dihydropyridazin-3-one, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 100mg.
4-bromo-2-(pyridin-4-ylmethyl)pyridazin-3-one (CAS 2251054-36-9) is a chemical compound with the molecular formula C10H8BrN3O and a molecular weight of 266.09 g/mol. IUPAC name: 4-bromo-2-(pyridin-4-ylmethyl)pyridazin-3-one. InChIKey: RTLHOBZXGWQESA-UHFFFAOYSA-N.
| Molecular formula | C10H8BrN3O |
|---|---|
| Molecular weight | 266.09 g/mol |
| IUPAC name | 4-bromo-2-(pyridin-4-ylmethyl)pyridazin-3-one |
| InChIKey | RTLHOBZXGWQESA-UHFFFAOYSA-N |
| SMILES | C1=CN=CC=C1CN2C(=O)C(=CC=N2)Br |
Computed by PubChem (NCBI)