cas: 220999-48-4 — see every product listed under this CAS number, including other names
4-((Diethylamino)methyl)phenylboronic Acid, 95+% (CAS 220999-48-4) is a chemical reagent available from Chemat. Available pack sizes: 100mg. Offered by: AmBeed.
| brand | AmBeed |
|---|---|
| catalog number | A823205-100mg |
| cas | 220999-48-4 |
| size | 100mg |
| availability | Synthetic Items: 0g |
| brand | size | price | |
|---|---|---|---|
| AmBeed | 100mg | 668.92 Pln |
| purity | 95+% |
|---|---|
| delivery time | To be confirmed by Chemat |
[4-(diethylaminomethyl)phenyl]boronic acid (CAS 220999-48-4) is a chemical compound with the molecular formula C11H18BNO2 and a molecular weight of 207.08 g/mol. IUPAC name: [4-(diethylaminomethyl)phenyl]boronic acid. InChIKey: WGXUKAGOUGPEOL-UHFFFAOYSA-N.
| Molecular formula | C11H18BNO2 |
|---|---|
| Molecular weight | 207.08 g/mol |
| IUPAC name | [4-(diethylaminomethyl)phenyl]boronic acid |
| InChIKey | WGXUKAGOUGPEOL-UHFFFAOYSA-N |
| SMILES | B(C1=CC=C(C=C1)CN(CC)CC)(O)O |
Computed by PubChem (NCBI)