cas: 126931-29-1 — see every product listed under this CAS number, including other names
4-((tert-Butyldimethylsilyl)oxy)cyclohexanol 95% (CAS 126931-29-1) is a chemical reagent available from Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 25g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A743805-100mg |
| cas | 126931-29-1 |
| size | 100mg |
| brand | size | price | |
|---|---|---|---|
| Ambeed | 100mg | 159.00 Pln | |
| Ambeed | 250mg | 236.88 Pln | |
| Ambeed | 1g | 381.50 Pln | |
| Ambeed | 5g | 1143.56 Pln | |
| Ambeed | 25g | 3846.94 Pln |
| purity | 95% |
|---|---|
| delivery time | 1-2 weeks |
| ambeed catalog no. | A743805 |
4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol (CAS 126931-29-1) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol. InChIKey: XGCCUZRKNCUVJK-UHFFFAOYSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol |
| InChIKey | XGCCUZRKNCUVJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC1)O |
Computed by PubChem (NCBI)