cas: 126931-29-1 — see every product listed under this CAS number, including other names
4-((tert-Butyldimethylsilyl)oxy)cyclohexanol, 97% (CAS 126931-29-1) is a chemical reagent available from Chemat. Available pack sizes: 250mg, 1g, 5g, 25g. Offered by: Fluorochem.
| brand | Fluorochem |
|---|---|
| catalog number | F323731-250MG |
| cas | 126931-29-1 |
| size | 250mg |
| brand | size | price | |
|---|---|---|---|
| Fluorochem | 250mg | 169.75 Pln | |
| Fluorochem | 1g | 331.15 Pln | |
| Fluorochem | 5g | 924.69 Pln | |
| Fluorochem | 25g | 3048.94 Pln |
| purity | 97% |
|---|---|
| delivery time | 3-4 weeks |
4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol (CAS 126931-29-1) is a chemical compound with the molecular formula C12H26O2Si and a molecular weight of 230.42 g/mol. IUPAC name: 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol. InChIKey: XGCCUZRKNCUVJK-UHFFFAOYSA-N.
| Molecular formula | C12H26O2Si |
|---|---|
| Molecular weight | 230.42 g/mol |
| IUPAC name | 4-[tert-butyl(dimethyl)silyl]oxycyclohexan-1-ol |
| InChIKey | XGCCUZRKNCUVJK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)[Si](C)(C)OC1CCC(CC1)O |
Computed by PubChem (NCBI)