4-(1-Methylcyclopropyl)aniline hydrochloride 98%
cas: 2172473-99-1 — see every product listed under this CAS number, including other names
4-(1-Methylcyclopropyl)aniline hydrochloride 98% (CAS 2172473-99-1) is a chemical reagent available from Chemat. Available pack sizes: 50mg, 100mg, 250mg, 1g, 5g. Offered by: Ambeed.
| brand | Ambeed |
|---|---|
| catalog number | A1421498-50mg |
| cas | 2172473-99-1 |
| size | 50mg |
Documents:
Safety Data Sheet (MSDS)
Available pack sizes
| brand | size | price | |
|---|---|---|---|
| Ambeed | 50mg | 1054.56 Pln | |
| Ambeed | 100mg | 1460.62 Pln | |
| Ambeed | 250mg | 2228.25 Pln | |
| Ambeed | 1g | 5615.81 Pln | |
| Ambeed | 5g | 15322.38 Pln |
properties
| purity | 98% |
|---|---|
| delivery time | 2-3 weeks |
| ambeed catalog no. | A1421498 |
4-(1-methylcyclopropyl)aniline;hydrochloride (CAS 2172473-99-1) is a chemical compound with the molecular formula C10H14ClN and a molecular weight of 183.68 g/mol. IUPAC name: 4-(1-methylcyclopropyl)aniline;hydrochloride. InChIKey: AXEHZAXXZVCVEO-UHFFFAOYSA-N.
| Molecular formula | C10H14ClN |
|---|---|
| Molecular weight | 183.68 g/mol |
| IUPAC name | 4-(1-methylcyclopropyl)aniline;hydrochloride |
| InChIKey | AXEHZAXXZVCVEO-UHFFFAOYSA-N |
| SMILES | CC1(CC1)C2=CC=C(C=C2)N.Cl |
Computed by PubChem (NCBI)